C15H4F17NaO4S — CID 101328615
sodium 4-[(E)-1,1,2,2,3,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-3-enoxy]benzenesulfonate (PubChem CID 101328615) has the molecular formula C15H4F17NaO4S and a molecular weight of 626.22 g/mol. Its IUPAC name is sodium 4-[(E)-1,1,2,2,3,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-3-enoxy]benzenesulfonate.
| Compound Name | sodium 4-[(E)-1,1,2,2,3,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-3-enoxy]benzenesulfonate |
|---|---|
| PubChem CID | 101328615 |
| Molecular Formula | C15H4F17NaO4S |
| Molecular Weight | 626.22 g/mol |
| Exact Mass | 625.95 |
| IUPAC Name | sodium 4-[(E)-1,1,2,2,3,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-3-enoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(OC(F)(F)C(F)(F)/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C15H5F17O4S.Na/c16-7(9(18,19)11(22,23)12(24,25)13(26,27)14(28,29)30)8(17)10(20,21)15(31,32)36-5-1-3-6(4-2-5)37(33,34)35;/h1-4H,(H,33,34,35);/q;+1/p-1/b8-7+; |
| InChIKey | TYGCUICBMFGHAJ-USRGLUTNSA-M |
| XLogP | 3.46 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|