C12H4F11NaO4S — CID 90473768
sodium 4-[(E)-1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy]benzenesulfonate (PubChem CID 90473768) has the molecular formula C12H4F11NaO4S and a molecular weight of 476.20 g/mol. Its IUPAC name is sodium 4-[(E)-1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy]benzenesulfonate.
| Compound Name | sodium 4-[(E)-1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy]benzenesulfonate |
|---|---|
| PubChem CID | 90473768 |
| Molecular Formula | C12H4F11NaO4S |
| Molecular Weight | 476.20 g/mol |
| Exact Mass | 475.96 |
| IUPAC Name | sodium 4-[(E)-1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(O/C(F)=C(\F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1.[Na+] |
| InChI | InChI=1S/C12H5F11O4S.Na/c13-7(9(15,16)10(17,18)11(19,20)12(21,22)23)8(14)27-5-1-3-6(4-2-5)28(24,25)26;/h1-4H,(H,24,25,26);/q;+1/p-1/b8-7-; |
| InChIKey | NGRPXRLJJPIWEW-CFYXSCKTSA-M |
| XLogP | 1.55 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|