C14H7F11O3 — CID 139811392
3-methyl-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzoic acid (PubChem CID 139811392) has the molecular formula C14H7F11O3 and a molecular weight of 432.19 g/mol. Its IUPAC name is 3-methyl-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzoic acid.
| Compound Name | 3-methyl-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzoic acid |
|---|---|
| PubChem CID | 139811392 |
| Molecular Formula | C14H7F11O3 |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 3-methyl-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzoic acid |
| SMILES | Cc1cc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc(C(=O)O)c1 |
| InChI | InChI=1S/C14H7F11O3/c1-5-2-6(10(26)27)4-7(3-5)28-9(16)8(15)11(17,18)12(19,20)13(21,22)14(23,24)25/h2-4H,1H3,(H,26,27) |
| InChIKey | KEYTUPSCPXTCLS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|