C14H2Cl3F11O3 — CID 139620920
4-chloro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,3-dicarbonyl chloride (PubChem CID 139620920) has the molecular formula C14H2Cl3F11O3 and a molecular weight of 533.50 g/mol. Its IUPAC name is 4-chloro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,3-dicarbonyl chloride.
| Compound Name | 4-chloro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 139620920 |
| Molecular Formula | C14H2Cl3F11O3 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 531.89 |
| IUPAC Name | 4-chloro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzene-1,3-dicarbonyl chloride |
| SMILES | O=C(Cl)c1cc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Cl)c(C(=O)Cl)c1 |
| InChI | InChI=1S/C14H2Cl3F11O3/c15-6-4(9(17)30)1-3(8(16)29)2-5(6)31-10(19)7(18)11(20,21)12(22,23)13(24,25)14(26,27)28/h1-2H |
| InChIKey | QKESRBMIJLUVDJ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|