C14H8BrF11O3 — CID 139647951
[4-bromo-2-(hydroxymethyl)-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]methanol (PubChem CID 139647951) has the molecular formula C14H8BrF11O3 and a molecular weight of 513.10 g/mol. Its IUPAC name is [4-bromo-2-(hydroxymethyl)-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]methanol.
| Compound Name | [4-bromo-2-(hydroxymethyl)-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]methanol |
|---|---|
| PubChem CID | 139647951 |
| Molecular Formula | C14H8BrF11O3 |
| Molecular Weight | 513.10 g/mol |
| Exact Mass | 511.95 |
| IUPAC Name | [4-bromo-2-(hydroxymethyl)-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)phenyl]methanol |
| SMILES | OCc1cc(Br)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1CO |
| InChI | InChI=1S/C14H8BrF11O3/c15-7-1-5(3-27)6(4-28)2-8(7)29-10(17)9(16)11(18,19)12(20,21)13(22,23)14(24,25)26/h1-2,27-28H,3-4H2 |
| InChIKey | BGOURJYQBWYATE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|