C13H18N2O4 — CID 134105211
[3-(butoxycarbonylamino)phenyl] N-methylcarbamate (PubChem CID 134105211) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is [3-(butoxycarbonylamino)phenyl] N-methylcarbamate.
| Compound Name | [3-(butoxycarbonylamino)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 134105211 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [3-(butoxycarbonylamino)phenyl] N-methylcarbamate |
| SMILES | CCCCOC(=O)Nc1cccc(OC(=O)NC)c1 |
| InChI | InChI=1S/C13H18N2O4/c1-3-4-8-18-13(17)15-10-6-5-7-11(9-10)19-12(16)14-2/h5-7,9H,3-4,8H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | AQJBKJOGDZKKKB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|