C13H16N2O3 — CID 6070588
[3-[[(E)-2-methylbut-2-enoyl]amino]phenyl] N-methylcarbamate (PubChem CID 6070588) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [3-[[(E)-2-methylbut-2-enoyl]amino]phenyl] N-methylcarbamate.
| Compound Name | [3-[[(E)-2-methylbut-2-enoyl]amino]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 6070588 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [3-[[(E)-2-methylbut-2-enoyl]amino]phenyl] N-methylcarbamate |
| SMILES | C/C=C(\C)C(=O)Nc1cccc(OC(=O)NC)c1 |
| InChI | InChI=1S/C13H16N2O3/c1-4-9(2)12(16)15-10-6-5-7-11(8-10)18-13(17)14-3/h4-8H,1-3H3,(H,14,17)(H,15,16)/b9-4+ |
| InChIKey | IAUOJNZQBAAHAZ-RUDMXATFSA-N |
| XLogP | 2.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|