C15H14ClN3O3 — CID 134123011
[3-[(2-chlorophenyl)carbamoylamino]phenyl] N-methylcarbamate (PubChem CID 134123011) has the molecular formula C15H14ClN3O3 and a molecular weight of 319.75 g/mol. Its IUPAC name is [3-[(2-chlorophenyl)carbamoylamino]phenyl] N-methylcarbamate.
| Compound Name | [3-[(2-chlorophenyl)carbamoylamino]phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 134123011 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [3-[(2-chlorophenyl)carbamoylamino]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(NC(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H14ClN3O3/c1-17-15(21)22-11-6-4-5-10(9-11)18-14(20)19-13-8-3-2-7-12(13)16/h2-9H,1H3,(H,17,21)(H2,18,19,20) |
| InChIKey | SEZATXZHYXTMCE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |