C15H13Cl2N3O3 — CID 134094489
[3-(methylcarbamoylamino)phenyl] N-(2,6-dichlorophenyl)carbamate (PubChem CID 134094489) has the molecular formula C15H13Cl2N3O3 and a molecular weight of 354.19 g/mol. Its IUPAC name is [3-(methylcarbamoylamino)phenyl] N-(2,6-dichlorophenyl)carbamate.
| Compound Name | [3-(methylcarbamoylamino)phenyl] N-(2,6-dichlorophenyl)carbamate |
|---|---|
| PubChem CID | 134094489 |
| Molecular Formula | C15H13Cl2N3O3 |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [3-(methylcarbamoylamino)phenyl] N-(2,6-dichlorophenyl)carbamate |
| SMILES | CNC(=O)Nc1cccc(OC(=O)Nc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3O3/c1-18-14(21)19-9-4-2-5-10(8-9)23-15(22)20-13-11(16)6-3-7-12(13)17/h2-8H,1H3,(H,20,22)(H2,18,19,21) |
| InChIKey | HCWVGQXGIHMMSI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |