C16H17N3O3 — CID 134123027
[3-(methylcarbamoylamino)phenyl] N-(4-methylphenyl)carbamate (PubChem CID 134123027) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is [3-(methylcarbamoylamino)phenyl] N-(4-methylphenyl)carbamate.
| Compound Name | [3-(methylcarbamoylamino)phenyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 134123027 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | [3-(methylcarbamoylamino)phenyl] N-(4-methylphenyl)carbamate |
| SMILES | CNC(=O)Nc1cccc(OC(=O)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-11-6-8-12(9-7-11)19-16(21)22-14-5-3-4-13(10-14)18-15(20)17-2/h3-10H,1-2H3,(H,19,21)(H2,17,18,20) |
| InChIKey | BUUGWGGCJDENBN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |