C18H18N4O2S — CID 54053966
O-[3-(methylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(4-methylphenyl)carbamothioate (PubChem CID 54053966) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is O-[3-(methylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(4-methylphenyl)carbamothioate.
| Compound Name | O-[3-(methylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(4-methylphenyl)carbamothioate |
|---|---|
| PubChem CID | 54053966 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | O-[3-(methylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(4-methylphenyl)carbamothioate |
| SMILES | CNC(=O)Nc1cccc(OC(=S)N(CC#N)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H18N4O2S/c1-13-6-8-15(9-7-13)22(11-10-19)18(25)24-16-5-3-4-14(12-16)21-17(23)20-2/h3-9,12H,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | LUXLZRGMSGKGHO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|