C23H30N2O3S — CID 154176695
[3-(propanethioylamino)phenyl] N-(2-butoxyethyl)-N-(4-methylphenyl)carbamate (PubChem CID 154176695) has the molecular formula C23H30N2O3S and a molecular weight of 414.57 g/mol. Its IUPAC name is [3-(propanethioylamino)phenyl] N-(2-butoxyethyl)-N-(4-methylphenyl)carbamate.
| Compound Name | [3-(propanethioylamino)phenyl] N-(2-butoxyethyl)-N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 154176695 |
| Molecular Formula | C23H30N2O3S |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | [3-(propanethioylamino)phenyl] N-(2-butoxyethyl)-N-(4-methylphenyl)carbamate |
| SMILES | CCCCOCCN(C(=O)Oc1cccc(NC(=S)CC)c1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O3S/c1-4-6-15-27-16-14-25(20-12-10-18(3)11-13-20)23(26)28-21-9-7-8-19(17-21)24-22(29)5-2/h7-13,17H,4-6,14-16H2,1-3H3,(H,24,29) |
| InChIKey | YICHVUSZVXAHFH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|