C18H16BrF3N2O2S — CID 57302650
[3-(ethanethioylamino)phenyl] N-(2-bromoethyl)-N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 57302650) has the molecular formula C18H16BrF3N2O2S and a molecular weight of 461.30 g/mol. Its IUPAC name is [3-(ethanethioylamino)phenyl] N-(2-bromoethyl)-N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [3-(ethanethioylamino)phenyl] N-(2-bromoethyl)-N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 57302650 |
| Molecular Formula | C18H16BrF3N2O2S |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | [3-(ethanethioylamino)phenyl] N-(2-bromoethyl)-N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(=S)Nc1cccc(OC(=O)N(CCBr)c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H16BrF3N2O2S/c1-12(27)23-14-5-3-7-16(11-14)26-17(25)24(9-8-19)15-6-2-4-13(10-15)18(20,21)22/h2-7,10-11H,8-9H2,1H3,(H,23,27) |
| InChIKey | OQQUSQVCILGONT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|