C19H22N2O4S — CID 154117139
[3-(ethanethioylamino)phenyl] N-(2-methoxyethyl)-N-(4-methoxyphenyl)carbamate (PubChem CID 154117139) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is [3-(ethanethioylamino)phenyl] N-(2-methoxyethyl)-N-(4-methoxyphenyl)carbamate.
| Compound Name | [3-(ethanethioylamino)phenyl] N-(2-methoxyethyl)-N-(4-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 154117139 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | [3-(ethanethioylamino)phenyl] N-(2-methoxyethyl)-N-(4-methoxyphenyl)carbamate |
| SMILES | COCCN(C(=O)Oc1cccc(NC(C)=S)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-14(26)20-15-5-4-6-18(13-15)25-19(22)21(11-12-23-2)16-7-9-17(24-3)10-8-16/h4-10,13H,11-12H2,1-3H3,(H,20,26) |
| InChIKey | APNIEMXZLIZKLP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|