C20H23BrN2O4 — CID 57260750
[3-(propan-2-yloxycarbonylamino)phenyl] N-(2-bromoethyl)-N-(4-methylphenyl)carbamate (PubChem CID 57260750) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is [3-(propan-2-yloxycarbonylamino)phenyl] N-(2-bromoethyl)-N-(4-methylphenyl)carbamate.
| Compound Name | [3-(propan-2-yloxycarbonylamino)phenyl] N-(2-bromoethyl)-N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 57260750 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | [3-(propan-2-yloxycarbonylamino)phenyl] N-(2-bromoethyl)-N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(N(CCBr)C(=O)Oc2cccc(NC(=O)OC(C)C)c2)cc1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-14(2)26-19(24)22-16-5-4-6-18(13-16)27-20(25)23(12-11-21)17-9-7-15(3)8-10-17/h4-10,13-14H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | WSJKCTGSWWUPHV-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|