C15H21ClN2O4 — CID 54450752
[3-(1-chloropropan-2-yloxycarbonylamino)phenyl] N,N-diethylcarbamate (PubChem CID 54450752) has the molecular formula C15H21ClN2O4 and a molecular weight of 328.80 g/mol. Its IUPAC name is [3-(1-chloropropan-2-yloxycarbonylamino)phenyl] N,N-diethylcarbamate.
| Compound Name | [3-(1-chloropropan-2-yloxycarbonylamino)phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 54450752 |
| Molecular Formula | C15H21ClN2O4 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [3-(1-chloropropan-2-yloxycarbonylamino)phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cccc(NC(=O)OC(C)CCl)c1 |
| InChI | InChI=1S/C15H21ClN2O4/c1-4-18(5-2)15(20)22-13-8-6-7-12(9-13)17-14(19)21-11(3)10-16/h6-9,11H,4-5,10H2,1-3H3,(H,17,19) |
| InChIKey | WUUNIBIEBFJFOI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|