C20H23ClN2O4 — CID 54062729
[3-(propan-2-yloxycarbonylamino)phenyl] N-benzyl-N-(2-chloroethyl)carbamate (PubChem CID 54062729) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is [3-(propan-2-yloxycarbonylamino)phenyl] N-benzyl-N-(2-chloroethyl)carbamate.
| Compound Name | [3-(propan-2-yloxycarbonylamino)phenyl] N-benzyl-N-(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 54062729 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | [3-(propan-2-yloxycarbonylamino)phenyl] N-benzyl-N-(2-chloroethyl)carbamate |
| SMILES | CC(C)OC(=O)Nc1cccc(OC(=O)N(CCCl)Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H23ClN2O4/c1-15(2)26-19(24)22-17-9-6-10-18(13-17)27-20(25)23(12-11-21)14-16-7-4-3-5-8-16/h3-10,13,15H,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | MAWCRBYHRIJMBD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|