C19H19N3O4 — CID 22756963
[3-(methoxycarbonylamino)phenyl] N-(2-cyanoethyl)-N-(3-methylphenyl)carbamate (PubChem CID 22756963) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-(methoxycarbonylamino)phenyl] N-(2-cyanoethyl)-N-(3-methylphenyl)carbamate.
| Compound Name | [3-(methoxycarbonylamino)phenyl] N-(2-cyanoethyl)-N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 22756963 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [3-(methoxycarbonylamino)phenyl] N-(2-cyanoethyl)-N-(3-methylphenyl)carbamate |
| SMILES | COC(=O)Nc1cccc(OC(=O)N(CCC#N)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-14-6-3-8-16(12-14)22(11-5-10-20)19(24)26-17-9-4-7-15(13-17)21-18(23)25-2/h3-4,6-9,12-13H,5,11H2,1-2H3,(H,21,23) |
| InChIKey | YFMYWZMYOLNQSH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |