C20H21N3O4 — CID 22756995
[3-(ethoxycarbonylamino)phenyl] N-(cyanomethyl)-N-(2,6-dimethylphenyl)carbamate (PubChem CID 22756995) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] N-(cyanomethyl)-N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] N-(cyanomethyl)-N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 22756995 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] N-(cyanomethyl)-N-(2,6-dimethylphenyl)carbamate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)N(CC#N)c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C20H21N3O4/c1-4-26-19(24)22-16-9-6-10-17(13-16)27-20(25)23(12-11-21)18-14(2)7-5-8-15(18)3/h5-10,13H,4,12H2,1-3H3,(H,22,24) |
| InChIKey | UYFHUABGYDZUIT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|