C20H20N4O3 — CID 54390288
[3-(prop-2-enylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(3-methylphenyl)carbamate (PubChem CID 54390288) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is [3-(prop-2-enylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(3-methylphenyl)carbamate.
| Compound Name | [3-(prop-2-enylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(3-methylphenyl)carbamate |
|---|---|
| PubChem CID | 54390288 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [3-(prop-2-enylcarbamoylamino)phenyl] N-(cyanomethyl)-N-(3-methylphenyl)carbamate |
| SMILES | C=CCNC(=O)Nc1cccc(OC(=O)N(CC#N)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-3-11-22-19(25)23-16-7-5-9-18(14-16)27-20(26)24(12-10-21)17-8-4-6-15(2)13-17/h3-9,13-14H,1,11-12H2,2H3,(H2,22,23,25) |
| InChIKey | VGDQKASBKMAMAZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|