C15H18ClN3O2S — CID 54259686
[3-[[2-chloroprop-2-enyl(methyl)carbamothioyl]amino]phenyl] N-prop-2-enylcarbamate (PubChem CID 54259686) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is [3-[[2-chloroprop-2-enyl(methyl)carbamothioyl]amino]phenyl] N-prop-2-enylcarbamate.
| Compound Name | [3-[[2-chloroprop-2-enyl(methyl)carbamothioyl]amino]phenyl] N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 54259686 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | [3-[[2-chloroprop-2-enyl(methyl)carbamothioyl]amino]phenyl] N-prop-2-enylcarbamate |
| SMILES | C=CCNC(=O)Oc1cccc(NC(=S)N(C)CC(=C)Cl)c1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-4-8-17-15(20)21-13-7-5-6-12(9-13)18-14(22)19(3)10-11(2)16/h4-7,9H,1-2,8,10H2,3H3,(H,17,20)(H,18,22) |
| InChIKey | RCPLAVHYBGPOQI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|