(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate

C12H14N2O2 — CID 116819905

IUPAC(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate
SMILESCc1cccc(OC(=O)N(C)CCC#N)c1
InChIInChI=1S/C12H14N2O2/c1-10-5-3-6-11(9-10)16-12(15)14(2)8-4-7-13/h3,5-6,9H,4,8H2,1-2H3
InChIKeyOXZDAQBFUZGAEY-UHFFFAOYSA-N
MW218.26 g/mol
LogP2.34
Rot. Bonds3

About (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate

(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate (PubChem CID 116819905) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate.

Molecular Properties

Compound Name(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate
PubChem CID116819905
Molecular FormulaC12H14N2O2
Molecular Weight218.26 g/mol
Exact Mass218.11
IUPAC Name(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate
SMILESCc1cccc(OC(=O)N(C)CCC#N)c1
InChIInChI=1S/C12H14N2O2/c1-10-5-3-6-11(9-10)16-12(15)14(2)8-4-7-13/h3,5-6,9H,4,8H2,1-2H3
InChIKeyOXZDAQBFUZGAEY-UHFFFAOYSA-N
XLogP2.34
TPSA53.33 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.26
LogP ≤ 52.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The IUPAC name of (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate (CID 116819905) is (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate.
What is the SMILES notation for (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The canonical SMILES for (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate is Cc1cccc(OC(=O)N(C)CCC#N)c1.
What is the InChIKey of (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
The InChIKey is OXZDAQBFUZGAEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-10-5-3-6-11(9-10)16-12(15)14(2)8-4-7-13/h3,5-6,9H,4,8H2,1-2H3.
What are the key properties of (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate?
(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate has a molecular weight of 218.26 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate is sourced from PubChem (CID 116819905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).