C12H14N2O2 — CID 116819905
(3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate (PubChem CID 116819905) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate.
| Compound Name | (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 116819905 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3-methylphenyl) N-(2-cyanoethyl)-N-methylcarbamate |
| SMILES | Cc1cccc(OC(=O)N(C)CCC#N)c1 |
| InChI | InChI=1S/C12H14N2O2/c1-10-5-3-6-11(9-10)16-12(15)14(2)8-4-7-13/h3,5-6,9H,4,8H2,1-2H3 |
| InChIKey | OXZDAQBFUZGAEY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |