About [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate
[3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate (PubChem CID 51154456) has the molecular formula C18H19NO4
and a molecular weight of 313.35 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate.
Molecular Properties
| Compound Name | [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate |
| PubChem CID | 51154456 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)CCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19NO4/c1-2-22-18(21)19-15-9-6-10-16(13-15)23-17(20)12-11-14-7-4-3-5-8-14/h3-10,13H,2,11-12H2,1H3,(H,19,21) |
| InChIKey | SMIQIESJFKVBSA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate?
The IUPAC name of [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate (CID 51154456) is [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate.
What is the SMILES notation for [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate?
The canonical SMILES for [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate is CCOC(=O)Nc1cccc(OC(=O)CCc2ccccc2)c1.
What is the InChIKey of [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate?
The InChIKey is SMIQIESJFKVBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO4/c1-2-22-18(21)19-15-9-6-10-16(13-15)23-17(20)12-11-14-7-4-3-5-8-14/h3-10,13H,2,11-12H2,1H3,(H,19,21).
What are the key properties of [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate?
[3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate has a molecular weight of 313.35 g/mol, XLogP of 3.79, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(ethoxycarbonylamino)phenyl] 3-phenylpropanoate is sourced from PubChem (CID 51154456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).