C16H19FN2O — CID 143402372
1-fluoro-3-methylbenzene;1-methyl-3-(4-methylphenyl)urea (PubChem CID 143402372) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-fluoro-3-methylbenzene;1-methyl-3-(4-methylphenyl)urea.
| Compound Name | 1-fluoro-3-methylbenzene;1-methyl-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 143402372 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-fluoro-3-methylbenzene;1-methyl-3-(4-methylphenyl)urea |
| SMILES | CNC(=O)Nc1ccc(C)cc1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C9H12N2O.C7H7F/c1-7-3-5-8(6-4-7)11-9(12)10-2;1-6-3-2-4-7(8)5-6/h3-6H,1-2H3,(H2,10,11,12);2-5H,1H3 |
| InChIKey | PTKQYDWAKPPPCQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |