C17H27N3O2S — CID 88777476
[3-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)phenyl] N-methylcarbamate (PubChem CID 88777476) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is [3-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)phenyl] N-methylcarbamate.
| Compound Name | [3-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)phenyl] N-methylcarbamate |
|---|---|
| PubChem CID | 88777476 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | [3-(2,4,4-trimethylpentan-2-ylcarbamothioylamino)phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc(NC(=S)NC(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C17H27N3O2S/c1-16(2,3)11-17(4,5)20-14(23)19-12-8-7-9-13(10-12)22-15(21)18-6/h7-10H,11H2,1-6H3,(H,18,21)(H2,19,20,23) |
| InChIKey | LCFQTAFEPOBXRH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|