C17H26N2O3 — CID 108865245
[3-(2,4,4-trimethylpentan-2-ylcarbamoylamino)phenyl] acetate (PubChem CID 108865245) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is [3-(2,4,4-trimethylpentan-2-ylcarbamoylamino)phenyl] acetate.
| Compound Name | [3-(2,4,4-trimethylpentan-2-ylcarbamoylamino)phenyl] acetate |
|---|---|
| PubChem CID | 108865245 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | [3-(2,4,4-trimethylpentan-2-ylcarbamoylamino)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(NC(=O)NC(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C17H26N2O3/c1-12(20)22-14-9-7-8-13(10-14)18-15(21)19-17(5,6)11-16(2,3)4/h7-10H,11H2,1-6H3,(H2,18,19,21) |
| InChIKey | PWNTVOMIIDDMLH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|