C9H2F16O — CID 175759797
1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-(2,2,3,3,3-pentafluoropropoxy)hex-1-ene (PubChem CID 175759797) has the molecular formula C9H2F16O and a molecular weight of 430.08 g/mol. Its IUPAC name is 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-(2,2,3,3,3-pentafluoropropoxy)hex-1-ene.
| Compound Name | 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-(2,2,3,3,3-pentafluoropropoxy)hex-1-ene |
|---|---|
| PubChem CID | 175759797 |
| Molecular Formula | C9H2F16O |
| Molecular Weight | 430.08 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 1,2,3,3,4,4,5,5,6,6,6-undecafluoro-1-(2,2,3,3,3-pentafluoropropoxy)hex-1-ene |
| SMILES | FC(OCC(F)(F)C(F)(F)F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H2F16O/c10-2(3(11)26-1-4(12,13)8(20,21)22)5(14,15)6(16,17)7(18,19)9(23,24)25/h1H2 |
| InChIKey | XLBNKJHHBXPEKJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.08 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|