C12H2F15NO — CID 139811452
2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)aniline (PubChem CID 139811452) has the molecular formula C12H2F15NO and a molecular weight of 461.12 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)aniline.
| Compound Name | 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)aniline |
|---|---|
| PubChem CID | 139811452 |
| Molecular Formula | C12H2F15NO |
| Molecular Weight | 461.12 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)aniline |
| SMILES | Nc1c(F)c(F)c(F)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C12H2F15NO/c13-1-2(14)5(28)4(16)6(3(1)15)29-8(18)7(17)9(19,20)10(21,22)11(23,24)12(25,26)27/h28H2 |
| InChIKey | KOQRNNYIVZCNNK-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.12 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|