C15H2F21NO — CID 139811474
2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)aniline (PubChem CID 139811474) has the molecular formula C15H2F21NO and a molecular weight of 611.14 g/mol. Its IUPAC name is 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)aniline.
| Compound Name | 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)aniline |
|---|---|
| PubChem CID | 139811474 |
| Molecular Formula | C15H2F21NO |
| Molecular Weight | 611.14 g/mol |
| Exact Mass | 610.98 |
| IUPAC Name | 2,3,4,6-tetrafluoro-5-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)aniline |
| SMILES | Nc1c(F)c(F)c(F)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C15H2F21NO/c16-1-2(17)5(37)4(19)6(3(1)18)38-8(21)7(20)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)36/h37H2 |
| InChIKey | ILGQWPXUHJMKMD-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.14 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|