C14F26O — CID 154941709
1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-(1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-2-enoxy)hept-2-ene (PubChem CID 154941709) has the molecular formula C14F26O and a molecular weight of 678.10 g/mol. Its IUPAC name is 1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-(1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-2-enoxy)hept-2-ene.
| Compound Name | 1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-(1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-2-enoxy)hept-2-ene |
|---|---|
| PubChem CID | 154941709 |
| Molecular Formula | C14F26O |
| Molecular Weight | 678.10 g/mol |
| Exact Mass | 677.95 |
| IUPAC Name | 1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-(1,1,2,3,4,4,5,5,6,6,7,7,7-tridecafluorohept-2-enoxy)hept-2-ene |
| SMILES | FC(=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)OC(F)(F)C(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14F26O/c15-1(5(19,20)9(27,28)11(31,32)13(35,36)37)3(17)7(23,24)41-8(25,26)4(18)2(16)6(21,22)10(29,30)12(33,34)14(38,39)40 |
| InChIKey | WUHBNHVZIDELOC-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.10 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|