C6F12O — CID 86252912
1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propane (PubChem CID 86252912) has the molecular formula C6F12O and a molecular weight of 316.04 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propane |
|---|---|
| PubChem CID | 86252912 |
| Molecular Formula | C6F12O |
| Molecular Weight | 316.04 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propane |
| SMILES | FC(F)=C(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F12O/c7-1(2(8)9)3(10,11)19-6(17,18)4(12,13)5(14,15)16 |
| InChIKey | NMIIWCRFNNKLNX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.04 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|