C12H8F16N2O — CID 142605367
1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propyl]-4-(1,1,2,2,2-pentafluoroethyl)piperazine (PubChem CID 142605367) has the molecular formula C12H8F16N2O and a molecular weight of 500.18 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propyl]-4-(1,1,2,2,2-pentafluoroethyl)piperazine.
| Compound Name | 1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propyl]-4-(1,1,2,2,2-pentafluoroethyl)piperazine |
|---|---|
| PubChem CID | 142605367 |
| Molecular Formula | C12H8F16N2O |
| Molecular Weight | 500.18 g/mol |
| Exact Mass | 500.04 |
| IUPAC Name | 1-[1,1,2,2,3,3-hexafluoro-3-(1,1,2,3,3-pentafluoroprop-2-enoxy)propyl]-4-(1,1,2,2,2-pentafluoroethyl)piperazine |
| SMILES | FC(F)=C(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)N1CCN(C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H8F16N2O/c13-5(6(14)15)7(16,17)31-12(27,28)8(18,19)10(23,24)29-1-3-30(4-2-29)11(25,26)9(20,21)22/h1-4H2 |
| InChIKey | KLADRJLUHYIRML-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.18 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|