C21F44O3 — CID 162167695
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoro-9-[tris(trifluoromethoxy)methyl]heptadecane (PubChem CID 162167695) has the molecular formula C21F44O3 and a molecular weight of 1136.14 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoro-9-[tris(trifluoromethoxy)methyl]heptadecane.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoro-9-[tris(trifluoromethoxy)methyl]heptadecane |
|---|---|
| PubChem CID | 162167695 |
| Molecular Formula | C21F44O3 |
| Molecular Weight | 1136.14 g/mol |
| Exact Mass | 1135.91 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,17,17,17-pentatriacontafluoro-9-[tris(trifluoromethoxy)methyl]heptadecane |
| SMILES | FC(F)(F)OC(OC(F)(F)F)(OC(F)(F)F)C(F)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21F44O3/c22-1(18(66-19(57,58)59,67-20(60,61)62)68-21(63,64)65,2(23,24)4(27,28)6(31,32)8(35,36)10(39,40)12(43,44)14(47,48)16(51,52)53)3(25,26)5(29,30)7(33,34)9(37,38)11(41,42)13(45,46)15(49,50)17(54,55)56 |
| InChIKey | GELMKFQQEXLEAS-UHFFFAOYSA-N |
| XLogP | 13.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1136.14 |
| LogP ≤ 5 | 13.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|