C11F23I — CID 174566096
2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane (PubChem CID 174566096) has the molecular formula C11F23I and a molecular weight of 695.98 g/mol. Its IUPAC name is 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane.
| Compound Name | 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
|---|---|
| PubChem CID | 174566096 |
| Molecular Formula | C11F23I |
| Molecular Weight | 695.98 g/mol |
| Exact Mass | 695.87 |
| IUPAC Name | 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)I |
| InChI | InChI=1S/C11F23I/c12-1(9(27,28)29,11(33,34)35)2(13,14)3(15,16)4(17,18)5(19,20)6(21,22)7(23,24)8(25,26)10(30,31)32 |
| InChIKey | SYWSPDUIHLXFPR-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.98 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|