C5F11I — CID 139983372
2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,4-nonafluorobutane (PubChem CID 139983372) has the molecular formula C5F11I and a molecular weight of 395.94 g/mol. Its IUPAC name is 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 139983372 |
| Molecular Formula | C5F11I |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.89 |
| IUPAC Name | 2-[difluoro(iodo)methyl]-1,1,1,2,3,3,4,4,4-nonafluorobutane |
| SMILES | FC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)I |
| InChI | InChI=1S/C5F11I/c6-1(3(9,10)11,5(15,16)17)2(7,8)4(12,13)14 |
| InChIKey | BSQMVWGUHWCKTM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|