C6HF12I — CID 88645116
1,1,1,2,2,3,3,4,5,5,6,6-dodecafluoro-6-iodohexane (PubChem CID 88645116) has the molecular formula C6HF12I and a molecular weight of 427.95 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,5,5,6,6-dodecafluoro-6-iodohexane.
| Compound Name | 1,1,1,2,2,3,3,4,5,5,6,6-dodecafluoro-6-iodohexane |
|---|---|
| PubChem CID | 88645116 |
| Molecular Formula | C6HF12I |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.89 |
| IUPAC Name | 1,1,1,2,2,3,3,4,5,5,6,6-dodecafluoro-6-iodohexane |
| SMILES | FC(C(F)(F)C(F)(F)I)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6HF12I/c7-1(3(10,11)6(17,18)19)2(8,9)4(12,13)5(14,15)16/h1H |
| InChIKey | XEWRKVVKCBVYQM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|