trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride

C7H10ClF8P — CID 87697367

IUPACtrimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride
SMILESC[P+](C)(C)C(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-]
InChIInChI=1S/C7H10F8P.ClH/c1-16(2,3)4(8)5(9,10)6(11,12)7(13,14)15;/h4H,1-3H3;1H/q+1;/p-1
InChIKeyRJIYSMVRBAIBLJ-UHFFFAOYSA-M
MW312.57 g/mol
LogP1.03
Rot. Bonds3

About trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride

trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride (PubChem CID 87697367) has the molecular formula C7H10ClF8P and a molecular weight of 312.57 g/mol. Its IUPAC name is trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride.

Molecular Properties

Compound Nametrimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride
PubChem CID87697367
Molecular FormulaC7H10ClF8P
Molecular Weight312.57 g/mol
Exact Mass312.01
IUPAC Nametrimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride
SMILESC[P+](C)(C)C(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-]
InChIInChI=1S/C7H10F8P.ClH/c1-16(2,3)4(8)5(9,10)6(11,12)7(13,14)15;/h4H,1-3H3;1H/q+1;/p-1
InChIKeyRJIYSMVRBAIBLJ-UHFFFAOYSA-M
XLogP1.03
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.57
LogP ≤ 51.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride?
The IUPAC name of trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride (CID 87697367) is trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride.
What is the SMILES notation for trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride?
The canonical SMILES for trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride is C[P+](C)(C)C(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-].
What is the InChIKey of trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride?
The InChIKey is RJIYSMVRBAIBLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10F8P.ClH/c1-16(2,3)4(8)5(9,10)6(11,12)7(13,14)15;/h4H,1-3H3;1H/q+1;/p-1.
What are the key properties of trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride?
trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride has a molecular weight of 312.57 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride is sourced from PubChem (CID 87697367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).