C7H10ClF8P — CID 87697367
trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride (PubChem CID 87697367) has the molecular formula C7H10ClF8P and a molecular weight of 312.57 g/mol. Its IUPAC name is trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride.
| Compound Name | trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride |
|---|---|
| PubChem CID | 87697367 |
| Molecular Formula | C7H10ClF8P |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | trimethyl(1,2,2,3,3,4,4,4-octafluorobutyl)phosphanium chloride |
| SMILES | C[P+](C)(C)C(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C7H10F8P.ClH/c1-16(2,3)4(8)5(9,10)6(11,12)7(13,14)15;/h4H,1-3H3;1H/q+1;/p-1 |
| InChIKey | RJIYSMVRBAIBLJ-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|