C7H5F11 — CID 91394956
1,1,1,2,3,3,4,4,5,6,6-undecafluoro-2-methylhexane (PubChem CID 91394956) has the molecular formula C7H5F11 and a molecular weight of 298.10 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,4,5,6,6-undecafluoro-2-methylhexane.
| Compound Name | 1,1,1,2,3,3,4,4,5,6,6-undecafluoro-2-methylhexane |
|---|---|
| PubChem CID | 91394956 |
| Molecular Formula | C7H5F11 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 1,1,1,2,3,3,4,4,5,6,6-undecafluoro-2-methylhexane |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C7H5F11/c1-4(11,7(16,17)18)6(14,15)5(12,13)2(8)3(9)10/h2-3H,1H3 |
| InChIKey | OSTQVVGHFGGTSG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|