C10H9F11O2 — CID 163999014
2,2,3,3,4,4,5,5,6,7,7-undecafluoroheptyl propanoate (PubChem CID 163999014) has the molecular formula C10H9F11O2 and a molecular weight of 370.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,7,7-undecafluoroheptyl propanoate.
| Compound Name | 2,2,3,3,4,4,5,5,6,7,7-undecafluoroheptyl propanoate |
|---|---|
| PubChem CID | 163999014 |
| Molecular Formula | C10H9F11O2 |
| Molecular Weight | 370.16 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,7,7-undecafluoroheptyl propanoate |
| SMILES | CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C10H9F11O2/c1-2-4(22)23-3-7(14,15)9(18,19)10(20,21)8(16,17)5(11)6(12)13/h5-6H,2-3H2,1H3 |
| InChIKey | UHHFLTYMSNPCGP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|