C5H5ClF6 — CID 19781251
2-chloro-1,1,1,3,4,4-hexafluoro-2-methylbutane (PubChem CID 19781251) has the molecular formula C5H5ClF6 and a molecular weight of 214.54 g/mol. Its IUPAC name is 2-chloro-1,1,1,3,4,4-hexafluoro-2-methylbutane.
| Compound Name | 2-chloro-1,1,1,3,4,4-hexafluoro-2-methylbutane |
|---|---|
| PubChem CID | 19781251 |
| Molecular Formula | C5H5ClF6 |
| Molecular Weight | 214.54 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-chloro-1,1,1,3,4,4-hexafluoro-2-methylbutane |
| SMILES | CC(Cl)(C(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H5ClF6/c1-4(6,5(10,11)12)2(7)3(8)9/h2-3H,1H3 |
| InChIKey | MODXMAFPGQWVAM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|