C6H5F9 — CID 86215913
1,1,1,2,3,4,5,5,5-nonafluoro-2-methylpentane (PubChem CID 86215913) has the molecular formula C6H5F9 and a molecular weight of 248.09 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-methylpentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-methylpentane |
|---|---|
| PubChem CID | 86215913 |
| Molecular Formula | C6H5F9 |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-methylpentane |
| SMILES | CC(F)(C(F)C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H5F9/c1-4(9,6(13,14)15)2(7)3(8)5(10,11)12/h2-3H,1H3 |
| InChIKey | WEIQFHTYJJAEES-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |