C6H6F7I — CID 2782603
1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)pentane (PubChem CID 2782603) has the molecular formula C6H6F7I and a molecular weight of 338.00 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 2782603 |
| Molecular Formula | C6H6F7I |
| Molecular Weight | 338.00 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 1,1,1,2-tetrafluoro-4-iodo-2-(trifluoromethyl)pentane |
| SMILES | CC(I)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F7I/c1-3(14)2-4(7,5(8,9)10)6(11,12)13/h3H,2H2,1H3 |
| InChIKey | DOOITBZJYVIFEO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.00 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|