C6H4F10 — CID 15044582
2-(difluoromethyl)-1,1,1,3,4,5,5,5-octafluoropentane (PubChem CID 15044582) has the molecular formula C6H4F10 and a molecular weight of 266.08 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,3,4,5,5,5-octafluoropentane.
| Compound Name | 2-(difluoromethyl)-1,1,1,3,4,5,5,5-octafluoropentane |
|---|---|
| PubChem CID | 15044582 |
| Molecular Formula | C6H4F10 |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,3,4,5,5,5-octafluoropentane |
| SMILES | FC(F)C(C(F)C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H4F10/c7-2(3(8)6(14,15)16)1(4(9)10)5(11,12)13/h1-4H |
| InChIKey | DNLWBPBGFCJCKE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |