C7H10F6 — CID 10727045
1,1,1,2,3,3-hexafluoro-4,4-dimethylpentane (PubChem CID 10727045) has the molecular formula C7H10F6 and a molecular weight of 208.15 g/mol. Its IUPAC name is 1,1,1,2,3,3-hexafluoro-4,4-dimethylpentane.
| Compound Name | 1,1,1,2,3,3-hexafluoro-4,4-dimethylpentane |
|---|---|
| PubChem CID | 10727045 |
| Molecular Formula | C7H10F6 |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1,1,1,2,3,3-hexafluoro-4,4-dimethylpentane |
| SMILES | CC(C)(C)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F6/c1-5(2,3)6(9,10)4(8)7(11,12)13/h4H,1-3H3 |
| InChIKey | MRHLZYMLHLVIMO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |