C5H7Cl2F3O — CID 13327472
3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol (PubChem CID 13327472) has the molecular formula C5H7Cl2F3O and a molecular weight of 211.01 g/mol. Its IUPAC name is 3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol.
| Compound Name | 3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 13327472 |
| Molecular Formula | C5H7Cl2F3O |
| Molecular Weight | 211.01 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 3,3-dichloro-4,4,4-trifluoro-2-methylbutan-2-ol |
| SMILES | CC(C)(O)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H7Cl2F3O/c1-3(2,11)4(6,7)5(8,9)10/h11H,1-2H3 |
| InChIKey | RPHGABSDHONMPT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.01 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|