About CID 155675070
CID 155675070 (PubChem CID 155675070) has the molecular formula C2H4ClOSb
and a molecular weight of 201.27 g/mol.
Molecular Properties
| Compound Name | CID 155675070 |
| PubChem CID | 155675070 |
| Molecular Formula | C2H4ClOSb |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 199.90 |
| IUPAC Name | — |
| SMILES | CC(O)(Cl)[Sb] |
| InChI | InChI=1S/C2H4ClO.Sb/c1-2(3)4;/h4H,1H3; |
| InChIKey | ZOTAHHBHGNGPAL-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 155675070 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 155675070?
The IUPAC name of CID 155675070 (CID 155675070) is not available.
What is the SMILES notation for CID 155675070?
The canonical SMILES for CID 155675070 is CC(O)(Cl)[Sb].
What is the InChIKey of CID 155675070?
The InChIKey is ZOTAHHBHGNGPAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClO.Sb/c1-2(3)4;/h4H,1H3;.
What are the key properties of CID 155675070?
CID 155675070 has a molecular weight of 201.27 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 155675070 is sourced from PubChem (CID 155675070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).