About bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate
bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate (PubChem CID 5284505) has the molecular formula C8H16Cl6O3
and a molecular weight of 372.93 g/mol. Its IUPAC name is bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate.
Molecular Properties
| Compound Name | bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate |
| PubChem CID | 5284505 |
| Molecular Formula | C8H16Cl6O3 |
| Molecular Weight | 372.93 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate |
| SMILES | CC(C)(O)C(Cl)(Cl)Cl.CC(C)(O)C(Cl)(Cl)Cl.O |
| InChI | InChI=1S/2C4H7Cl3O.H2O/c2*1-3(2,8)4(5,6)7;/h2*8H,1-2H3;1H2 |
| InChIKey | WRWLCXJYIMRJIN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate?
The IUPAC name of bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate (CID 5284505) is bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate.
What is the SMILES notation for bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate?
The canonical SMILES for bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate is CC(C)(O)C(Cl)(Cl)Cl.CC(C)(O)C(Cl)(Cl)Cl.O.
What is the InChIKey of bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate?
The InChIKey is WRWLCXJYIMRJIN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H7Cl3O.H2O/c2*1-3(2,8)4(5,6)7;/h2*8H,1-2H3;1H2.
What are the key properties of bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate?
bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate has a molecular weight of 372.93 g/mol, XLogP of 3.43, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1,1,1-trichloro-2-methylpropan-2-ol);hydrate is sourced from PubChem (CID 5284505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).