C14H16F14O — CID 121250084
1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)-3-[1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)pentan-3-yl]oxypentane (PubChem CID 121250084) has the molecular formula C14H16F14O and a molecular weight of 466.25 g/mol. Its IUPAC name is 1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)-3-[1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)pentan-3-yl]oxypentane.
| Compound Name | 1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)-3-[1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)pentan-3-yl]oxypentane |
|---|---|
| PubChem CID | 121250084 |
| Molecular Formula | C14H16F14O |
| Molecular Weight | 466.25 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | 1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)-3-[1,1,1,2,2,4-hexafluoro-3-(1-fluoroethyl)pentan-3-yl]oxypentane |
| SMILES | CC(F)C(OC(C(C)F)(C(C)F)C(F)(F)C(F)(F)F)(C(C)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H16F14O/c1-5(15)9(6(2)16,11(19,20)13(23,24)25)29-10(7(3)17,8(4)18)12(21,22)14(26,27)28/h5-8H,1-4H3 |
| InChIKey | RWFDCFGCYHNYMQ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.25 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|