C22H14Br2F30O — CID 22906175
8-bromo-8-(3-bromo-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methyldecan-3-yl)oxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-9-methyldecane (PubChem CID 22906175) has the molecular formula C22H14Br2F30O and a molecular weight of 1024.10 g/mol. Its IUPAC name is 8-bromo-8-(3-bromo-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methyldecan-3-yl)oxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-9-methyldecane.
| Compound Name | 8-bromo-8-(3-bromo-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methyldecan-3-yl)oxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-9-methyldecane |
|---|---|
| PubChem CID | 22906175 |
| Molecular Formula | C22H14Br2F30O |
| Molecular Weight | 1024.10 g/mol |
| Exact Mass | 1021.89 |
| IUPAC Name | 8-bromo-8-(3-bromo-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-methyldecan-3-yl)oxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoro-9-methyldecane |
| SMILES | CC(C)C(Br)(OC(Br)(C(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H14Br2F30O/c1-5(2)7(23,9(25,26)11(29,30)13(33,34)15(37,38)17(41,42)19(45,46)21(49,50)51)55-8(24,6(3)4)10(27,28)12(31,32)14(35,36)16(39,40)18(43,44)20(47,48)22(52,53)54/h5-6H,1-4H3 |
| InChIKey | UJIZOMGONSSBFH-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1024.10 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|