C14Br2F28O — CID 88521020
3-bromo-2-[3-bromo-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexane (PubChem CID 88521020) has the molecular formula C14Br2F28O and a molecular weight of 875.90 g/mol. Its IUPAC name is 3-bromo-2-[3-bromo-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexane.
| Compound Name | 3-bromo-2-[3-bromo-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 88521020 |
| Molecular Formula | C14Br2F28O |
| Molecular Weight | 875.90 g/mol |
| Exact Mass | 873.79 |
| IUPAC Name | 3-bromo-2-[3-bromo-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexan-2-yl]oxy-1,1,1,3,4,4,5,5,6,6,6-undecafluoro-2-(trifluoromethyl)hexane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(Br)C(OC(C(F)(F)F)(C(F)(F)F)C(F)(Br)C(F)(F)C(F)(F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14Br2F28O/c15-3(17,5(19,20)7(23,24)13(39,40)41)1(9(27,28)29,10(30,31)32)45-2(11(33,34)35,12(36,37)38)4(16,18)6(21,22)8(25,26)14(42,43)44 |
| InChIKey | KIRSRIFCMGEDCL-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.90 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|